About CID 10762335
CID 10762335 (PubChem CID 10762335) has the molecular formula C21H32O6
and a molecular weight of 380.48 g/mol.
Molecular Properties
| Compound Name | CID 10762335 |
| PubChem CID | 10762335 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | — |
| SMILES | C=CCO[C@H]1[C@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C21H32O6/c1-2-13-23-15-14(22)16-18(26-20(24-16)9-5-3-6-10-20)19-17(15)25-21(27-19)11-7-4-8-12-21/h2,14-19,22H,1,3-13H2/t14-,15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | KEBPNIMBCDESEN-KZYORJDKSA-N |
| XLogP | 2.82 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 10762335 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10762335?
The IUPAC name of CID 10762335 (CID 10762335) is not available.
What is the SMILES notation for CID 10762335?
The canonical SMILES for CID 10762335 is C=CCO[C@H]1[C@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@@H]21.
What is the InChIKey of CID 10762335?
The InChIKey is KEBPNIMBCDESEN-KZYORJDKSA-N. The full InChI is InChI=1S/C21H32O6/c1-2-13-23-15-14(22)16-18(26-20(24-16)9-5-3-6-10-20)19-17(15)25-21(27-19)11-7-4-8-12-21/h2,14-19,22H,1,3-13H2/t14-,15-,16-,17+,18-,19-/m0/s1.
What are the key properties of CID 10762335?
CID 10762335 has a molecular weight of 380.48 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10762335 is sourced from PubChem (CID 10762335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).