About methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate
methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate (PubChem CID 1076254) has the molecular formula C20H20N2O7
and a molecular weight of 400.39 g/mol. Its IUPAC name is methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate |
| PubChem CID | 1076254 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1-n1cnc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C20H20N2O7/c1-25-15-6-11-13(8-17(15)27-3)21-10-22(19(11)23)14-9-18(28-4)16(26-2)7-12(14)20(24)29-5/h6-10H,1-5H3 |
| InChIKey | PFKKMUZFGISJDT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate?
The IUPAC name of methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate (CID 1076254) is methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate.
What is the SMILES notation for methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate?
The canonical SMILES for methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate is COC(=O)c1cc(OC)c(OC)cc1-n1cnc2cc(OC)c(OC)cc2c1=O.
What is the InChIKey of methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate?
The InChIKey is PFKKMUZFGISJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O7/c1-25-15-6-11-13(8-17(15)27-3)21-10-22(19(11)23)14-9-18(28-4)16(26-2)7-12(14)20(24)29-5/h6-10H,1-5H3.
What are the key properties of methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate?
methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate has a molecular weight of 400.39 g/mol, XLogP of 2.21, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-4,5-dimethoxybenzoate is sourced from PubChem (CID 1076254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).