C13H19IN2OS — CID 107627206
N-ethyl-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-N-methylacetamide (PubChem CID 107627206) has the molecular formula C13H19IN2OS and a molecular weight of 378.28 g/mol. Its IUPAC name is N-ethyl-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-N-methylacetamide.
| Compound Name | N-ethyl-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 107627206 |
| Molecular Formula | C13H19IN2OS |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-ethyl-2-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]-N-methylacetamide |
| SMILES | CCN(C)C(=O)CNC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C13H19IN2OS/c1-3-16(2)13(17)8-15-10-5-4-6-11-9(10)7-12(14)18-11/h7,10,15H,3-6,8H2,1-2H3 |
| InChIKey | MOJLMFDRKXOZJB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|