About N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide
N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide (PubChem CID 10762739) has the molecular formula C24H22N2O3
and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide.
Molecular Properties
| Compound Name | N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide |
| PubChem CID | 10762739 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCOCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-17-6-2-4-8-21(17)23(27)25-20-12-10-18(11-13-20)24(28)26-14-15-29-16-19-7-3-5-9-22(19)26/h2-13H,14-16H2,1H3,(H,25,27) |
| InChIKey | PKJHHJMHOFCZLY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide?
The IUPAC name of N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide (CID 10762739) is N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide.
What is the SMILES notation for N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide?
The canonical SMILES for N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide is Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCOCc3ccccc32)cc1.
What is the InChIKey of N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide?
The InChIKey is PKJHHJMHOFCZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O3/c1-17-6-2-4-8-21(17)23(27)25-20-12-10-18(11-13-20)24(28)26-14-15-29-16-19-7-3-5-9-22(19)26/h2-13H,14-16H2,1H3,(H,25,27).
What are the key properties of N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide?
N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide has a molecular weight of 386.45 g/mol, XLogP of 4.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,5-dihydro-2H-4,1-benzoxazepine-1-carbonyl)phenyl]-2-methylbenzamide is sourced from PubChem (CID 10762739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).