C14H16ClIN2O3 — CID 107628481
1-[(4-chloro-2-iodophenyl)carbamoyl]-4-methylpiperidine-2-carboxylic acid (PubChem CID 107628481) has the molecular formula C14H16ClIN2O3 and a molecular weight of 422.65 g/mol. Its IUPAC name is 1-[(4-chloro-2-iodophenyl)carbamoyl]-4-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-[(4-chloro-2-iodophenyl)carbamoyl]-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107628481 |
| Molecular Formula | C14H16ClIN2O3 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 1-[(4-chloro-2-iodophenyl)carbamoyl]-4-methylpiperidine-2-carboxylic acid |
| SMILES | CC1CCN(C(=O)Nc2ccc(Cl)cc2I)C(C(=O)O)C1 |
| InChI | InChI=1S/C14H16ClIN2O3/c1-8-4-5-18(12(6-8)13(19)20)14(21)17-11-3-2-9(15)7-10(11)16/h2-3,7-8,12H,4-6H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | MNNDFNNNDSILOM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|