C13H15BrN2O — CID 107628624
7-bromo-2-(methoxymethyl)-N,8-dimethylquinolin-4-amine (PubChem CID 107628624) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 7-bromo-2-(methoxymethyl)-N,8-dimethylquinolin-4-amine.
| Compound Name | 7-bromo-2-(methoxymethyl)-N,8-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 107628624 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 7-bromo-2-(methoxymethyl)-N,8-dimethylquinolin-4-amine |
| SMILES | CNc1cc(COC)nc2c(C)c(Br)ccc12 |
| InChI | InChI=1S/C13H15BrN2O/c1-8-11(14)5-4-10-12(15-2)6-9(7-17-3)16-13(8)10/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | RGHMXNYOYHFCGI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |