C17H23ClN2 — CID 107628768
8-chloro-2,5-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine (PubChem CID 107628768) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 8-chloro-2,5-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine.
| Compound Name | 8-chloro-2,5-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 107628768 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 8-chloro-2,5-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C(C)C)c(C)nc2c(Cl)ccc(C)c12 |
| InChI | InChI=1S/C17H23ClN2/c1-6-9-19-17-14(10(2)3)12(5)20-16-13(18)8-7-11(4)15(16)17/h7-8,10H,6,9H2,1-5H3,(H,19,20) |
| InChIKey | XBAAFDUXSBDTEH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |