C13H14BrFN2O4 — CID 107628968
5-[[(2-bromo-5-fluorophenyl)carbamoylamino]methyl]oxolane-2-carboxylic acid (PubChem CID 107628968) has the molecular formula C13H14BrFN2O4 and a molecular weight of 361.17 g/mol. Its IUPAC name is 5-[[(2-bromo-5-fluorophenyl)carbamoylamino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[(2-bromo-5-fluorophenyl)carbamoylamino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 107628968 |
| Molecular Formula | C13H14BrFN2O4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-[[(2-bromo-5-fluorophenyl)carbamoylamino]methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(NCC1CCC(C(=O)O)O1)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H14BrFN2O4/c14-9-3-1-7(15)5-10(9)17-13(20)16-6-8-2-4-11(21-8)12(18)19/h1,3,5,8,11H,2,4,6H2,(H,18,19)(H2,16,17,20) |
| InChIKey | GZNPFOVRKFQUOO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |