About 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide
6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 10762959) has the molecular formula C20H21Cl2N3O
and a molecular weight of 390.31 g/mol. Its IUPAC name is 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide |
| PubChem CID | 10762959 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C20H21Cl2N3O/c1-3-11-24(12-4-2)20(26)19-18(14-5-7-15(21)8-6-14)23-17-10-9-16(22)13-25(17)19/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | WKXXXZWVEXHHAD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide?
The IUPAC name of 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide (CID 10762959) is 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide.
What is the SMILES notation for 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide?
The canonical SMILES for 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide is CCCN(CCC)C(=O)c1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12.
What is the InChIKey of 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide?
The InChIKey is WKXXXZWVEXHHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2N3O/c1-3-11-24(12-4-2)20(26)19-18(14-5-7-15(21)8-6-14)23-17-10-9-16(22)13-25(17)19/h5-10,13H,3-4,11-12H2,1-2H3.
What are the key properties of 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide?
6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide has a molecular weight of 390.31 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(4-chlorophenyl)-N,N-dipropylimidazo[1,2-a]pyridine-3-carboxamide is sourced from PubChem (CID 10762959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).