C23H25N3O3 — CID 10763038
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-quinazoline-2,4-dione (PubChem CID 10763038) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10763038 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-quinazoline-2,4-dione |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCn3c(=O)[nH]c4ccccc4c3=O)C[C@@H]21 |
| InChI | InChI=1S/C23H25N3O3/c1-29-21-8-4-6-16-17(21)10-9-15-13-25(14-19(15)16)11-12-26-22(27)18-5-2-3-7-20(18)24-23(26)28/h2-8,15,19H,9-14H2,1H3,(H,24,28)/t15-,19+/m0/s1 |
| InChIKey | QYTLWWWPYDZRAG-HNAYVOBHSA-N |
| XLogP | 2.36 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |