C11H16ClNO2 — CID 107630559
2-chloro-N-(2,2-dimethoxyethyl)-5-methylaniline (PubChem CID 107630559) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethoxyethyl)-5-methylaniline.
| Compound Name | 2-chloro-N-(2,2-dimethoxyethyl)-5-methylaniline |
|---|---|
| PubChem CID | 107630559 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-chloro-N-(2,2-dimethoxyethyl)-5-methylaniline |
| SMILES | COC(CNc1cc(C)ccc1Cl)OC |
| InChI | InChI=1S/C11H16ClNO2/c1-8-4-5-9(12)10(6-8)13-7-11(14-2)15-3/h4-6,11,13H,7H2,1-3H3 |
| InChIKey | QQONUBBHRFLFBV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|