About 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one
5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 10763072) has the molecular formula C20H12N2O7
and a molecular weight of 392.32 g/mol. Its IUPAC name is 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 10763072 |
| Molecular Formula | C20H12N2O7 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C20H12N2O7/c21-15-8-14-11(7-16(15)22(26)27)19(25)29-20(14)12-3-1-9(23)5-17(12)28-18-6-10(24)2-4-13(18)20/h1-8,23-24H,21H2 |
| InChIKey | MRDXZTUJOJTMQI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one (CID 10763072) is 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one is Nc1cc2c(cc1[N+](=O)[O-])C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.
What is the InChIKey of 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is MRDXZTUJOJTMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O7/c21-15-8-14-11(7-16(15)22(26)27)19(25)29-20(14)12-3-1-9(23)5-17(12)28-18-6-10(24)2-4-13(18)20/h1-8,23-24H,21H2.
What are the key properties of 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one?
5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 392.32 g/mol, XLogP of 3.16, 1 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 10763072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).