C12H12ClIN4OS — CID 107631539
N-(4-chloro-2-iodophenyl)-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 107631539) has the molecular formula C12H12ClIN4OS and a molecular weight of 422.68 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 107631539 |
| Molecular Formula | C12H12ClIN4OS |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCNc1nnc(C(=O)Nc2ccc(Cl)cc2I)s1 |
| InChI | InChI=1S/C12H12ClIN4OS/c1-2-5-15-12-18-17-11(20-12)10(19)16-9-4-3-7(13)6-8(9)14/h3-4,6H,2,5H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | CQMFQOBDNTVVJR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|