C17H16Cl2IN — CID 107631566
6-chloro-N-(4-chloro-2-iodophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine (PubChem CID 107631566) has the molecular formula C17H16Cl2IN and a molecular weight of 432.13 g/mol. Its IUPAC name is 6-chloro-N-(4-chloro-2-iodophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine.
| Compound Name | 6-chloro-N-(4-chloro-2-iodophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 107631566 |
| Molecular Formula | C17H16Cl2IN |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | 6-chloro-N-(4-chloro-2-iodophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
| SMILES | CC1(C)Cc2ccc(Cl)cc2C1Nc1ccc(Cl)cc1I |
| InChI | InChI=1S/C17H16Cl2IN/c1-17(2)9-10-3-4-11(18)7-13(10)16(17)21-15-6-5-12(19)8-14(15)20/h3-8,16,21H,9H2,1-2H3 |
| InChIKey | PGTUZFJGJGHZAI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|