C14H13BrFN3O — CID 107631593
N-(2-bromo-5-fluorophenyl)-2-(ethylamino)pyridine-3-carboxamide (PubChem CID 107631593) has the molecular formula C14H13BrFN3O and a molecular weight of 338.18 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-2-(ethylamino)pyridine-3-carboxamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)-2-(ethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107631593 |
| Molecular Formula | C14H13BrFN3O |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-2-(ethylamino)pyridine-3-carboxamide |
| SMILES | CCNc1ncccc1C(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C14H13BrFN3O/c1-2-17-13-10(4-3-7-18-13)14(20)19-12-8-9(16)5-6-11(12)15/h3-8H,2H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | AOKIVRDFEXIPLP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |