C9H9ClF2IN — CID 107632154
4-chloro-N-(1,1-difluoropropan-2-yl)-2-iodoaniline (PubChem CID 107632154) has the molecular formula C9H9ClF2IN and a molecular weight of 331.53 g/mol. Its IUPAC name is 4-chloro-N-(1,1-difluoropropan-2-yl)-2-iodoaniline.
| Compound Name | 4-chloro-N-(1,1-difluoropropan-2-yl)-2-iodoaniline |
|---|---|
| PubChem CID | 107632154 |
| Molecular Formula | C9H9ClF2IN |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 4-chloro-N-(1,1-difluoropropan-2-yl)-2-iodoaniline |
| SMILES | CC(Nc1ccc(Cl)cc1I)C(F)F |
| InChI | InChI=1S/C9H9ClF2IN/c1-5(9(11)12)14-8-3-2-6(10)4-7(8)13/h2-5,9,14H,1H3 |
| InChIKey | PBEKNRHICWDNMO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|