C23H28N2O4 — CID 10763300
(4R,4aS,6E,7aR,12bS)-3-(cyclopropylmethyl)-6-(dimethylaminomethylidene)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10763300) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (4R,4aS,6E,7aR,12bS)-3-(cyclopropylmethyl)-6-(dimethylaminomethylidene)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,6E,7aR,12bS)-3-(cyclopropylmethyl)-6-(dimethylaminomethylidene)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10763300 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (4R,4aS,6E,7aR,12bS)-3-(cyclopropylmethyl)-6-(dimethylaminomethylidene)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CN(C)/C=C1\C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@@H](O5)C1=O |
| InChI | InChI=1S/C23H28N2O4/c1-24(2)12-15-10-23(28)17-9-14-5-6-16(26)20-18(14)22(23,21(29-20)19(15)27)7-8-25(17)11-13-3-4-13/h5-6,12-13,17,21,26,28H,3-4,7-11H2,1-2H3/b15-12+/t17-,21+,22+,23-/m1/s1 |
| InChIKey | PEKMMPRNUWEWAH-ADSZKXICSA-N |
| XLogP | 1.58 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|