C17H26ClNO2 — CID 107634648
1-(2-chloro-5-methylanilino)-3-(3-methylcyclohexyl)oxypropan-2-ol (PubChem CID 107634648) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is 1-(2-chloro-5-methylanilino)-3-(3-methylcyclohexyl)oxypropan-2-ol.
| Compound Name | 1-(2-chloro-5-methylanilino)-3-(3-methylcyclohexyl)oxypropan-2-ol |
|---|---|
| PubChem CID | 107634648 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(2-chloro-5-methylanilino)-3-(3-methylcyclohexyl)oxypropan-2-ol |
| SMILES | Cc1ccc(Cl)c(NCC(O)COC2CCCC(C)C2)c1 |
| InChI | InChI=1S/C17H26ClNO2/c1-12-4-3-5-15(8-12)21-11-14(20)10-19-17-9-13(2)6-7-16(17)18/h6-7,9,12,14-15,19-20H,3-5,8,10-11H2,1-2H3 |
| InChIKey | XXHWUSGHMXZTSH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |