About S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate
S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate (PubChem CID 10763660) has the molecular formula C20H38O4SSi
and a molecular weight of 402.67 g/mol. Its IUPAC name is S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate.
Molecular Properties
| Compound Name | S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate |
| PubChem CID | 10763660 |
| Molecular Formula | C20H38O4SSi |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate |
| SMILES | CCSC(=O)[C@H](C/C=C(/C)COC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4SSi/c1-8-25-19(21)17(24-26(6,7)20(3,4)5)13-12-16(2)15-23-18-11-9-10-14-22-18/h12,17-18H,8-11,13-15H2,1-7H3/b16-12-/t17-,18?/m0/s1 |
| InChIKey | XNSNXHCTRJAVAV-GYQFQRNCSA-N |
| XLogP | 5.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate?
The IUPAC name of S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate (CID 10763660) is S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate.
What is the SMILES notation for S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate?
The canonical SMILES for S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate is CCSC(=O)[C@H](C/C=C(/C)COC1CCCCO1)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate?
The InChIKey is XNSNXHCTRJAVAV-GYQFQRNCSA-N. The full InChI is InChI=1S/C20H38O4SSi/c1-8-25-19(21)17(24-26(6,7)20(3,4)5)13-12-16(2)15-23-18-11-9-10-14-22-18/h12,17-18H,8-11,13-15H2,1-7H3/b16-12-/t17-,18?/m0/s1.
What are the key properties of S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate?
S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate has a molecular weight of 402.67 g/mol, XLogP of 5.54, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(oxan-2-yloxy)hex-4-enethioate is sourced from PubChem (CID 10763660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).