About 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate (PubChem CID 10763843) has the molecular formula C10H9F3N2O6S3
and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate |
| PubChem CID | 10763843 |
| Molecular Formula | C10H9F3N2O6S3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate |
| SMILES | NS(=O)(=O)c1nc2ccc(OCCOS(=O)(=O)C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C10H9F3N2O6S3/c11-10(12,13)24(18,19)21-4-3-20-6-1-2-7-8(5-6)22-9(15-7)23(14,16)17/h1-2,5H,3-4H2,(H2,14,16,17) |
| InChIKey | DMOIIDXHXUHFJK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate?
The IUPAC name of 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate (CID 10763843) is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate.
What is the SMILES notation for 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate?
The canonical SMILES for 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate is NS(=O)(=O)c1nc2ccc(OCCOS(=O)(=O)C(F)(F)F)cc2s1.
What is the InChIKey of 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate?
The InChIKey is DMOIIDXHXUHFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O6S3/c11-10(12,13)24(18,19)21-4-3-20-6-1-2-7-8(5-6)22-9(15-7)23(14,16)17/h1-2,5H,3-4H2,(H2,14,16,17).
What are the key properties of 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate?
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate has a molecular weight of 406.39 g/mol, XLogP of 1.19, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl trifluoromethanesulfonate is sourced from PubChem (CID 10763843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).