C12H11ClN2O2S — CID 107638510
methyl 2-(2-chloro-5-methylanilino)-1,3-thiazole-5-carboxylate (PubChem CID 107638510) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is methyl 2-(2-chloro-5-methylanilino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(2-chloro-5-methylanilino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 107638510 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | methyl 2-(2-chloro-5-methylanilino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cc(C)ccc2Cl)s1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7-3-4-8(13)9(5-7)15-12-14-6-10(18-12)11(16)17-2/h3-6H,1-2H3,(H,14,15) |
| InChIKey | HQOOBCCJBNHULZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |