About 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide
2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide (PubChem CID 107641392) has the molecular formula C10H11FN4O2S2
and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide |
| PubChem CID | 107641392 |
| Molecular Formula | C10H11FN4O2S2 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2cc(F)ccc2N)s1 |
| InChI | InChI=1S/C10H11FN4O2S2/c1-2-9-13-14-10(18-9)15-19(16,17)8-5-6(11)3-4-7(8)12/h3-5H,2,12H2,1H3,(H,14,15) |
| InChIKey | URMWLLHJTALLLK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide?
The IUPAC name of 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide (CID 107641392) is 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide.
What is the SMILES notation for 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide?
The canonical SMILES for 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide is CCc1nnc(NS(=O)(=O)c2cc(F)ccc2N)s1.
What is the InChIKey of 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide?
The InChIKey is URMWLLHJTALLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN4O2S2/c1-2-9-13-14-10(18-9)15-19(16,17)8-5-6(11)3-4-7(8)12/h3-5H,2,12H2,1H3,(H,14,15).
What are the key properties of 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide?
2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide has a molecular weight of 302.36 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-fluorobenzenesulfonamide is sourced from PubChem (CID 107641392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).