C12H12F4N2O3 — CID 107642210
4-[methyl-[(2,3,5,6-tetrafluorophenyl)carbamoyl]amino]butanoic acid (PubChem CID 107642210) has the molecular formula C12H12F4N2O3 and a molecular weight of 308.23 g/mol. Its IUPAC name is 4-[methyl-[(2,3,5,6-tetrafluorophenyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[(2,3,5,6-tetrafluorophenyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107642210 |
| Molecular Formula | C12H12F4N2O3 |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[methyl-[(2,3,5,6-tetrafluorophenyl)carbamoyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H12F4N2O3/c1-18(4-2-3-8(19)20)12(21)17-11-9(15)6(13)5-7(14)10(11)16/h5H,2-4H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | PKRIXEPHOIYPEN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|