C9H4F4N4O — CID 107642769
N-(2,3,5,6-tetrafluorophenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 107642769) has the molecular formula C9H4F4N4O and a molecular weight of 260.15 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 107642769 |
| Molecular Formula | C9H4F4N4O |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1ncn[nH]1 |
| InChI | InChI=1S/C9H4F4N4O/c10-3-1-4(11)6(13)7(5(3)12)16-9(18)8-14-2-15-17-8/h1-2H,(H,16,18)(H,14,15,17) |
| InChIKey | IREFDXBRQZVDTO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|