About (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol
(1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol (PubChem CID 10764319) has the molecular formula C20H40OSn
and a molecular weight of 415.25 g/mol. Its IUPAC name is (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol.
Molecular Properties
| Compound Name | (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol |
| PubChem CID | 10764319 |
| Molecular Formula | C20H40OSn |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol |
| SMILES | CC/C=C\CC(O)/C=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C8H13O.3C4H9.Sn/c1-3-5-6-7-8(9)4-2;3*1-3-4-2;/h2,4-6,8-9H,3,7H2,1H3;3*1,3-4H2,2H3;/b4-2?,6-5-;;;; |
| InChIKey | PHFAJTSZSJVVQP-JHSPRNFXSA-N |
| XLogP | 6.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol?
The IUPAC name of (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol (CID 10764319) is (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol.
What is the SMILES notation for (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol?
The canonical SMILES for (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol is CC/C=C\CC(O)/C=C/[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol?
The InChIKey is PHFAJTSZSJVVQP-JHSPRNFXSA-N. The full InChI is InChI=1S/C8H13O.3C4H9.Sn/c1-3-5-6-7-8(9)4-2;3*1-3-4-2;/h2,4-6,8-9H,3,7H2,1H3;3*1,3-4H2,2H3;/b4-2?,6-5-;;;;.
What are the key properties of (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol?
(1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol has a molecular weight of 415.25 g/mol, XLogP of 6.65, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,5Z)-1-tributylstannylocta-1,5-dien-3-ol is sourced from PubChem (CID 10764319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).