About N-ethyl-2,3,5,6-tetrafluoroaniline
N-ethyl-2,3,5,6-tetrafluoroaniline (PubChem CID 107643264) has the molecular formula C8H7F4N
and a molecular weight of 193.14 g/mol. Its IUPAC name is N-ethyl-2,3,5,6-tetrafluoroaniline.
Molecular Properties
| Compound Name | N-ethyl-2,3,5,6-tetrafluoroaniline |
| PubChem CID | 107643264 |
| Molecular Formula | C8H7F4N |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | N-ethyl-2,3,5,6-tetrafluoroaniline |
| SMILES | CCNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H7F4N/c1-2-13-8-6(11)4(9)3-5(10)7(8)12/h3,13H,2H2,1H3 |
| InChIKey | DJSCFUJEXSRHCY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,3,5,6-tetrafluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3,5,6-tetrafluoroaniline?
The IUPAC name of N-ethyl-2,3,5,6-tetrafluoroaniline (CID 107643264) is N-ethyl-2,3,5,6-tetrafluoroaniline.
What is the SMILES notation for N-ethyl-2,3,5,6-tetrafluoroaniline?
The canonical SMILES for N-ethyl-2,3,5,6-tetrafluoroaniline is CCNc1c(F)c(F)cc(F)c1F.
What is the InChIKey of N-ethyl-2,3,5,6-tetrafluoroaniline?
The InChIKey is DJSCFUJEXSRHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F4N/c1-2-13-8-6(11)4(9)3-5(10)7(8)12/h3,13H,2H2,1H3.
What are the key properties of N-ethyl-2,3,5,6-tetrafluoroaniline?
N-ethyl-2,3,5,6-tetrafluoroaniline has a molecular weight of 193.14 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3,5,6-tetrafluoroaniline is sourced from PubChem (CID 107643264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).