C15H18N2OS — CID 107643474
2-ethoxy-4-N-(2-methylsulfanylphenyl)benzene-1,4-diamine (PubChem CID 107643474) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-ethoxy-4-N-(2-methylsulfanylphenyl)benzene-1,4-diamine.
| Compound Name | 2-ethoxy-4-N-(2-methylsulfanylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 107643474 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-ethoxy-4-N-(2-methylsulfanylphenyl)benzene-1,4-diamine |
| SMILES | CCOc1cc(Nc2ccccc2SC)ccc1N |
| InChI | InChI=1S/C15H18N2OS/c1-3-18-14-10-11(8-9-12(14)16)17-13-6-4-5-7-15(13)19-2/h4-10,17H,3,16H2,1-2H3 |
| InChIKey | OJALCNOTVGLJHC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|