C14H11F4NO2 — CID 107643564
4-[1-(2,3,5,6-tetrafluoroanilino)ethyl]benzene-1,3-diol (PubChem CID 107643564) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is 4-[1-(2,3,5,6-tetrafluoroanilino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2,3,5,6-tetrafluoroanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107643564 |
| Molecular Formula | C14H11F4NO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[1-(2,3,5,6-tetrafluoroanilino)ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1c(F)c(F)cc(F)c1F)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H11F4NO2/c1-6(8-3-2-7(20)4-11(8)21)19-14-12(17)9(15)5-10(16)13(14)18/h2-6,19-21H,1H3 |
| InChIKey | ZGTUPFFJHIFRDE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|