C11H11F4NS — CID 107643661
N-(2,3,5,6-tetrafluorophenyl)thian-3-amine (PubChem CID 107643661) has the molecular formula C11H11F4NS and a molecular weight of 265.27 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)thian-3-amine.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)thian-3-amine |
|---|---|
| PubChem CID | 107643661 |
| Molecular Formula | C11H11F4NS |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)thian-3-amine |
| SMILES | Fc1cc(F)c(F)c(NC2CCCSC2)c1F |
| InChI | InChI=1S/C11H11F4NS/c12-7-4-8(13)10(15)11(9(7)14)16-6-2-1-3-17-5-6/h4,6,16H,1-3,5H2 |
| InChIKey | ZFEVCVIBUUPGPS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|