C16H19F4N — CID 107643806
N-(2,3,5,6-tetrafluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 107643806) has the molecular formula C16H19F4N and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 107643806 |
| Molecular Formula | C16H19F4N |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | Fc1cc(F)c(F)c(NC2CCC3CCCCC3C2)c1F |
| InChI | InChI=1S/C16H19F4N/c17-12-8-13(18)15(20)16(14(12)19)21-11-6-5-9-3-1-2-4-10(9)7-11/h8-11,21H,1-7H2 |
| InChIKey | NXKYGGHIWAAQJQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|