C18H27NO10 — CID 10764423
triethyl [(2S,3R,4S)-4-ethoxycarbonyl-2-(hydroxymethyl)-5-oxopyrrolidin-3-yl]methanetricarboxylate (PubChem CID 10764423) has the molecular formula C18H27NO10 and a molecular weight of 417.41 g/mol. Its IUPAC name is triethyl [(2S,3R,4S)-4-ethoxycarbonyl-2-(hydroxymethyl)-5-oxopyrrolidin-3-yl]methanetricarboxylate.
| Compound Name | triethyl [(2S,3R,4S)-4-ethoxycarbonyl-2-(hydroxymethyl)-5-oxopyrrolidin-3-yl]methanetricarboxylate |
|---|---|
| PubChem CID | 10764423 |
| Molecular Formula | C18H27NO10 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | triethyl [(2S,3R,4S)-4-ethoxycarbonyl-2-(hydroxymethyl)-5-oxopyrrolidin-3-yl]methanetricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N[C@H](CO)[C@H]1C(C(=O)OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H27NO10/c1-5-26-14(22)11-12(10(9-20)19-13(11)21)18(15(23)27-6-2,16(24)28-7-3)17(25)29-8-4/h10-12,20H,5-9H2,1-4H3,(H,19,21)/t10-,11+,12-/m1/s1 |
| InChIKey | YRBPVMPLININRI-GRYCIOLGSA-N |
| XLogP | -1.05 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|