C15H15F2NOS — CID 107644662
1-(2,4-difluorophenyl)-2-(2-methylsulfanylanilino)ethanol (PubChem CID 107644662) has the molecular formula C15H15F2NOS and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(2-methylsulfanylanilino)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(2-methylsulfanylanilino)ethanol |
|---|---|
| PubChem CID | 107644662 |
| Molecular Formula | C15H15F2NOS |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(2-methylsulfanylanilino)ethanol |
| SMILES | CSc1ccccc1NCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H15F2NOS/c1-20-15-5-3-2-4-13(15)18-9-14(19)11-7-6-10(16)8-12(11)17/h2-8,14,18-19H,9H2,1H3 |
| InChIKey | ZEAUESVTJHTLEC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |