C11H10F4N2S — CID 107645457
5-ethyl-N-(2,3,5,6-tetrafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 107645457) has the molecular formula C11H10F4N2S and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-ethyl-N-(2,3,5,6-tetrafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-ethyl-N-(2,3,5,6-tetrafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107645457 |
| Molecular Formula | C11H10F4N2S |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-ethyl-N-(2,3,5,6-tetrafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1CN=C(Nc2c(F)c(F)cc(F)c2F)S1 |
| InChI | InChI=1S/C11H10F4N2S/c1-2-5-4-16-11(18-5)17-10-8(14)6(12)3-7(13)9(10)15/h3,5H,2,4H2,1H3,(H,16,17) |
| InChIKey | UAOGUCQFCGRCIS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|