C13H14F4N2S — CID 107645461
4,4-diethyl-N-(2,3,5,6-tetrafluorophenyl)-5H-1,3-thiazol-2-amine (PubChem CID 107645461) has the molecular formula C13H14F4N2S and a molecular weight of 306.33 g/mol. Its IUPAC name is 4,4-diethyl-N-(2,3,5,6-tetrafluorophenyl)-5H-1,3-thiazol-2-amine.
| Compound Name | 4,4-diethyl-N-(2,3,5,6-tetrafluorophenyl)-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107645461 |
| Molecular Formula | C13H14F4N2S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4,4-diethyl-N-(2,3,5,6-tetrafluorophenyl)-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2c(F)c(F)cc(F)c2F)=N1 |
| InChI | InChI=1S/C13H14F4N2S/c1-3-13(4-2)6-20-12(19-13)18-11-9(16)7(14)5-8(15)10(11)17/h5H,3-4,6H2,1-2H3,(H,18,19) |
| InChIKey | BEAOUYRLOLFPRL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|