C14H10F4OS — CID 107645687
1-[5-(2,3,5,6-tetrafluorophenyl)thiophen-2-yl]butan-1-one (PubChem CID 107645687) has the molecular formula C14H10F4OS and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-[5-(2,3,5,6-tetrafluorophenyl)thiophen-2-yl]butan-1-one.
| Compound Name | 1-[5-(2,3,5,6-tetrafluorophenyl)thiophen-2-yl]butan-1-one |
|---|---|
| PubChem CID | 107645687 |
| Molecular Formula | C14H10F4OS |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-[5-(2,3,5,6-tetrafluorophenyl)thiophen-2-yl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(-c2c(F)c(F)cc(F)c2F)s1 |
| InChI | InChI=1S/C14H10F4OS/c1-2-3-9(19)10-4-5-11(20-10)12-13(17)7(15)6-8(16)14(12)18/h4-6H,2-3H2,1H3 |
| InChIKey | KLYRIKCSXFRENP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|