C13H8F4O2 — CID 107645707
1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-one (PubChem CID 107645707) has the molecular formula C13H8F4O2 and a molecular weight of 272.20 g/mol. Its IUPAC name is 1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-one.
| Compound Name | 1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 107645707 |
| Molecular Formula | C13H8F4O2 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(-c2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C13H8F4O2/c1-6(18)4-7-2-3-10(19-7)11-12(16)8(14)5-9(15)13(11)17/h2-3,5H,4H2,1H3 |
| InChIKey | JWTNSXTYWOVXEH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|