C11H11F4N3O2 — CID 107645731
(3Z)-3-amino-3-hydroxyimino-2,2-dimethyl-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 107645731) has the molecular formula C11H11F4N3O2 and a molecular weight of 293.22 g/mol. Its IUPAC name is (3Z)-3-amino-3-hydroxyimino-2,2-dimethyl-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | (3Z)-3-amino-3-hydroxyimino-2,2-dimethyl-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 107645731 |
| Molecular Formula | C11H11F4N3O2 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (3Z)-3-amino-3-hydroxyimino-2,2-dimethyl-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | CC(C)(C(=O)Nc1c(F)c(F)cc(F)c1F)/C(N)=N/O |
| InChI | InChI=1S/C11H11F4N3O2/c1-11(2,9(16)18-20)10(19)17-8-6(14)4(12)3-5(13)7(8)15/h3,20H,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | NAWYSVDOECUPKH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|