C13H9F4N3O — CID 107645811
3-amino-2-(2,3,5,6-tetrafluoroanilino)benzamide (PubChem CID 107645811) has the molecular formula C13H9F4N3O and a molecular weight of 299.23 g/mol. Its IUPAC name is 3-amino-2-(2,3,5,6-tetrafluoroanilino)benzamide.
| Compound Name | 3-amino-2-(2,3,5,6-tetrafluoroanilino)benzamide |
|---|---|
| PubChem CID | 107645811 |
| Molecular Formula | C13H9F4N3O |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-amino-2-(2,3,5,6-tetrafluoroanilino)benzamide |
| SMILES | NC(=O)c1cccc(N)c1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H9F4N3O/c14-6-4-7(15)10(17)12(9(6)16)20-11-5(13(19)21)2-1-3-8(11)18/h1-4,20H,18H2,(H2,19,21) |
| InChIKey | YDJAWTZRKROHNR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|