C15H15N3OS — CID 107646342
13-ethyl-9,9-dimethyl-8-oxa-14-thia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene (PubChem CID 107646342) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 13-ethyl-9,9-dimethyl-8-oxa-14-thia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene.
| Compound Name | 13-ethyl-9,9-dimethyl-8-oxa-14-thia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene |
|---|---|
| PubChem CID | 107646342 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 13-ethyl-9,9-dimethyl-8-oxa-14-thia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene |
| SMILES | CCc1nn2c3c(nc2s1)-c1ccccc1OC3(C)C |
| InChI | InChI=1S/C15H15N3OS/c1-4-11-17-18-13-12(16-14(18)20-11)9-7-5-6-8-10(9)19-15(13,2)3/h5-8H,4H2,1-3H3 |
| InChIKey | SRWJMYHFNPMCIF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |