C9H11N3O2S2 — CID 107646427
4-ethyl-5,11λ6-dithia-2,3,7-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene 11,11-dioxide (PubChem CID 107646427) has the molecular formula C9H11N3O2S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-ethyl-5,11λ6-dithia-2,3,7-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene 11,11-dioxide.
| Compound Name | 4-ethyl-5,11λ6-dithia-2,3,7-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene 11,11-dioxide |
|---|---|
| PubChem CID | 107646427 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-ethyl-5,11λ6-dithia-2,3,7-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene 11,11-dioxide |
| SMILES | CCc1nn2c3c(nc2s1)CCS(=O)(=O)C3 |
| InChI | InChI=1S/C9H11N3O2S2/c1-2-8-11-12-7-5-16(13,14)4-3-6(7)10-9(12)15-8/h2-5H2,1H3 |
| InChIKey | IRYWIMPRGISFHK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |