C11H7N3S2 — CID 107646806
8,14-dithia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene (PubChem CID 107646806) has the molecular formula C11H7N3S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is 8,14-dithia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene.
| Compound Name | 8,14-dithia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene |
|---|---|
| PubChem CID | 107646806 |
| Molecular Formula | C11H7N3S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 8,14-dithia-11,12,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene |
| SMILES | c1ccc2c(c1)SCc1c-2nc2scnn12 |
| InChI | InChI=1S/C11H7N3S2/c1-2-4-9-7(3-1)10-8(5-15-9)14-11(13-10)16-6-12-14/h1-4,6H,5H2 |
| InChIKey | WGTPMFTVWVMKBQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |