C8H9N3OS — CID 107646966
6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 107646966) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 107646966 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | CCc1nc2sc(C)nn2c1C=O |
| InChI | InChI=1S/C8H9N3OS/c1-3-6-7(4-12)11-8(9-6)13-5(2)10-11/h4H,3H2,1-2H3 |
| InChIKey | VJLDGJBKZVSYPF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|