C10H17N3OS — CID 107647717
N-(3-ethoxycyclobutyl)-5-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 107647717) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(3-ethoxycyclobutyl)-5-ethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3-ethoxycyclobutyl)-5-ethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107647717 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(3-ethoxycyclobutyl)-5-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCOC1CC(Nc2nnc(CC)s2)C1 |
| InChI | InChI=1S/C10H17N3OS/c1-3-9-12-13-10(15-9)11-7-5-8(6-7)14-4-2/h7-8H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | XTYGGPAVDAOGKC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |