C12H16N4O2S2 — CID 107648074
4-[1-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 107648074) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-[1-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[1-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107648074 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-[1-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CCc1nnc(NC(C)c2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-3-11-15-16-12(19-11)14-8(2)9-4-6-10(7-5-9)20(13,17)18/h4-8H,3H2,1-2H3,(H,14,16)(H2,13,17,18) |
| InChIKey | OVCMIESGMHRXRV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |