C9H9BrN4S — CID 107648229
N-[(6-bromo-2-pyridinyl)methyl]-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 107648229) has the molecular formula C9H9BrN4S and a molecular weight of 285.17 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-5-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-5-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648229 |
| Molecular Formula | C9H9BrN4S |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(NCc2cccc(Br)n2)s1 |
| InChI | InChI=1S/C9H9BrN4S/c1-6-13-14-9(15-6)11-5-7-3-2-4-8(10)12-7/h2-4H,5H2,1H3,(H,11,14) |
| InChIKey | XZTFHBFEQPNFRV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|