C12H17N3S — CID 107648835
N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648835) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648835 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1nnc(NC2CC3CC2C2CCCC32)s1 |
| InChI | InChI=1S/C12H17N3S/c1-2-8-7-4-10(9(8)3-1)11(5-7)14-12-15-13-6-16-12/h6-11H,1-5H2,(H,14,15) |
| InChIKey | SNGZOKSEGVSLNX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |