C15H11N3OS — CID 107648848
N-(9H-xanthen-9-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648848) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(9H-xanthen-9-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(9H-xanthen-9-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648848 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | N-(9H-xanthen-9-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc2c(c1)Oc1ccccc1C2Nc1nncs1 |
| InChI | InChI=1S/C15H11N3OS/c1-3-7-12-10(5-1)14(17-15-18-16-9-20-15)11-6-2-4-8-13(11)19-12/h1-9,14H,(H,17,18) |
| InChIKey | WZPKGSUVGKIYDT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |