C11H12BrN3OS — CID 107648855
N-[1-(3-bromo-4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 107648855) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is N-[1-(3-bromo-4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648855 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccc(C(C)Nc2nncs2)cc1Br |
| InChI | InChI=1S/C11H12BrN3OS/c1-7(14-11-15-13-6-17-11)8-3-4-10(16-2)9(12)5-8/h3-7H,1-2H3,(H,14,15) |
| InChIKey | NUFCQOYVXQWSHG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |