C15H21BrFNO2S — CID 107650272
4-bromo-N-(1-cyclohexylpropyl)-3-fluorobenzenesulfonamide (PubChem CID 107650272) has the molecular formula C15H21BrFNO2S and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-bromo-N-(1-cyclohexylpropyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(1-cyclohexylpropyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107650272 |
| Molecular Formula | C15H21BrFNO2S |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-bromo-N-(1-cyclohexylpropyl)-3-fluorobenzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(Br)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H21BrFNO2S/c1-2-15(11-6-4-3-5-7-11)18-21(19,20)12-8-9-13(16)14(17)10-12/h8-11,15,18H,2-7H2,1H3 |
| InChIKey | LFJAUUKXKZERGW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |