C24H35NO2SSi — CID 10765039
tert-butyl-dimethyl-[(E,1R,2R)-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1-phenylbut-3-enoxy]silane (PubChem CID 10765039) has the molecular formula C24H35NO2SSi and a molecular weight of 429.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,1R,2R)-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1-phenylbut-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,1R,2R)-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1-phenylbut-3-enoxy]silane |
|---|---|
| PubChem CID | 10765039 |
| Molecular Formula | C24H35NO2SSi |
| Molecular Weight | 429.70 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | tert-butyl-dimethyl-[(E,1R,2R)-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1-phenylbut-3-enoxy]silane |
| SMILES | CN=S(=O)(/C=C/[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H35NO2SSi/c1-20(18-19-28(26,25-5)22-16-12-9-13-17-22)23(21-14-10-8-11-15-21)27-29(6,7)24(2,3)4/h8-20,23H,1-7H3/b19-18+/t20-,23-,28?/m1/s1 |
| InChIKey | IOIIWCMZTABSGK-SPERNMBZSA-N |
| XLogP | 7.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.70 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|